PRODUCTS
PRODUCTS
Chloromethyl isopropyl carbonate |
| Product name: | Chloromethyl isopropyl carbonate |
| CAS No.: | 35180-01-9 |
| Molecular weight: | 152.5762 |
| Molecular formula: | C5H9ClO3 |
| InChI: | InChI=1/C5H9ClO3/c1-4(2)9-5(7)8-3-6/h4H,3H2,1-2H3 |
| Structural formula: |  |
| Density: | 1.15g/cm3 |
| Boiling point: | 147.463°C at 760 mmHg |
| Flash point: | 49.952°C |
| Vapor pressure: | 4.419mmHg at 25°C |
| Uses: | Used as an intermediate of organic synthesis, anti-aids and hepatitis b drug tenofovir intermediate |
