PRODUCTS
PRODUCTS
2-Chlorobenzothiazole |
| Product name: | 2-Chlorobenzothiazole |
| CAS No.: | 615-20-3 |
| EINECS No.: | 210-415-0 |
| Molecular weight: | 169.6314 |
| Molecular formula: | C7H4ClNS |
| InChI: | InChI=1/C7H4ClNS/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H |
| Structural formula: |  |
| Density: | 1.435g/cm3 |
| Melting point: | 21-23℃ |
| Water solubility: | insoluble |
| Boiling point: | 248°C at 760 mmHg |
| Flash point: | 103.8°C |
| Vapor pressure: | 0.0392mmHg at 25°C |
| Uses: | Used for the production of the Mefenacet-rice field herbicide |
