PRODUCTS
PRODUCTS
Triethylamine |
| Product name: | Triethylamine |
| CAS No.: | 121-44-8 |
| EINECS No.: | 204-469-4 |
| Molecular weight: | 101.1918 |
| Molecular formula: | C6H15N |
| InChI: | InChI=1/C6H15N.H2O4S/c1-4-7(5-2)6-3;1-5(2,3)4/h4-6H2,1-3H3;(H2,1,2,3,4) |
| Structural formula: |  |
| Density: | 0.728 |
| Melting point: | -115℃ |
| Water solubility: | 133 g/L (20℃) |
| Boiling point: | 90.5°C at 760 mmHg |
| Flash point: | 139.4°C |
| Vapor pressure: | 56.1mmHg at 25°C |
| Uses: | Used in the manufacture of medicine, pesticide, resistance, high energy fuel, rubber vulcanization |
